4-Chloro-8-ethylquinoline-3-carboxylic acid ethyl ester structure
|
Common Name | 4-Chloro-8-ethylquinoline-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 113515-72-3 | Molecular Weight | 263.71900 | |
| Density | 1.221g/cm3 | Boiling Point | 359.2ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | ethyl 4-chloro-8-ethylquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 359.2ºC at 760 mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 171ºC |
| Exact Mass | 263.07100 |
| PSA | 39.19000 |
| LogP | 3.62730 |
| Vapour Pressure | 2.42E-05mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | WSVHEJIPUHPQMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(CC)cccc2c1Cl |
|
~95%
4-Chloro-8-ethy... CAS#:113515-72-3 |
| Literature: US4904651 A1, ; |
|
~%
4-Chloro-8-ethy... CAS#:113515-72-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 8 p. 1487 - 1490 |
|
~%
4-Chloro-8-ethy... CAS#:113515-72-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 8 p. 1487 - 1490 |
| 4-Chloro-8-ethylquinoline-3-carboxylic acid ethyl ester |
| 3-Quinolinecarboxylic acid,4-chloro-8-ethyl-,ethyl ester |