EGF/FGF/PDGF receptor tyrosine kinase inhibitor structure
|
Common Name | EGF/FGF/PDGF receptor tyrosine kinase inhibitor | ||
|---|---|---|---|---|
| CAS Number | 1135256-66-4 | Molecular Weight | 405.28 | |
| Density | ~1.4 g/cm3(Predicted) | Boiling Point | 594.56° C (Predicted) | |
| Molecular Formula | C18H18Cl2N6O | Melting Point | 256.77° C (Predicted) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | EGF/FGF/PDGF receptor tyrosine kinase inhibitor |
|---|---|
| Synonym | More Synonyms |
| Density | ~1.4 g/cm3(Predicted) |
|---|---|
| Boiling Point | 594.56° C (Predicted) |
| Melting Point | 256.77° C (Predicted) |
| Molecular Formula | C18H18Cl2N6O |
| Molecular Weight | 405.28 |
| Exact Mass | 404.091919 |
| LogP | 2.12 |
| Index of Refraction | n20D1.69 (Predicted) |
| InChIKey | NOFYQGPZJZWBEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)Nc1nc2nc(N)ncc2cc1-c1cc(Cl)cc(Cl)c1 |
| Water Solubility | Soluble in DMSO (25 mg/ml), and ethanol (1 mg/ml). |
| 1-(2-Amino-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-yl)-3-tert-butyl urea |
| PDGFR Tyrosine Kinase Inhibitor XIII |
| PD 089828 |
| Urea, N-[2-amino-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-yl]-N'-(1,1-dimethylethyl)- |
| 1-[2-amino-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-tert-butylurea |
| 1-[2-Amino-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-(2-methyl-2-propanyl)urea |