Glycine,N-(carboxymethyl)-N-phenyl- structure
|
Common Name | Glycine,N-(carboxymethyl)-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1137-73-1 | Molecular Weight | 209.19900 | |
| Density | 1.397g/cm3 | Boiling Point | 451.2ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | 156 °C | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | n-phenyliminodiacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 451.2ºC at 760mmHg |
| Melting Point | 156 °C |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 226.7ºC |
| Exact Mass | 209.06900 |
| PSA | 77.84000 |
| LogP | 0.66220 |
| Vapour Pressure | 6.25E-09mmHg at 25°C |
| InChIKey | GQBWTAGIANQVGB-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CC(=O)O)c1ccccc1 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD00043570 |
| N-Phenyliminodiacetic acid |
| 2-[N-(carboxymethyl)anilino]acetic acid |