Mal-amido-PEG10-C2-NHS ester structure
|
Common Name | Mal-amido-PEG10-C2-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1137109-22-8 | Molecular Weight | 777.81000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H55N3O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-amido-PEG10-C2-NHS esterMal-amido-PEG10-C2-NHS ester is a nonclaevable ADC linker containing a maleimide group and an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules[1][2]. |
| Name | Mal-PEG10-NHS |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-amido-PEG10-C2-NHS ester is a nonclaevable ADC linker containing a maleimide group and an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| References |
| Molecular Formula | C34H55N3O17 |
|---|---|
| Molecular Weight | 777.81000 |
| Exact Mass | 777.35300 |
| PSA | 222.46000 |
| InChIKey | DUKFGPQZJAPKMG-UHFFFAOYSA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| α-Maleimidopropionyl-ω-succinimidyl-10(ethylene glycol) |