N-t-Boc-4-Hydroxy-L-pyrrolidine lactone structure
|
Common Name | N-t-Boc-4-Hydroxy-L-pyrrolidine lactone | ||
|---|---|---|---|---|
| CAS Number | 113775-22-7 | Molecular Weight | 213.230 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 349.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H15NO4 | Melting Point | 109 - 114 ℃ | |
| MSDS | Chinese USA | Flash Point | 165.3±25.9 °C | |
| Name | (1S,4S)-tert-Butyl 3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.7±35.0 °C at 760 mmHg |
| Melting Point | 109 - 114 ℃ |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.230 |
| Flash Point | 165.3±25.9 °C |
| Exact Mass | 213.100113 |
| PSA | 55.84000 |
| LogP | -0.52 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | LRUFZHMJIBJMPC-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C(=O)O2 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| N-Boc-4-hydroxy-L-pyrrolidine lactone |
| 2-Methyl-2-propanyl (1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate |
| (1S,4S)-tert-Butyl-3-oxo-2-oxa-5-azabicyclo-[2.2.1]heptane-5-carboxylate |
| 2-Oxa-5-azabicyclo[2.2.1]heptane-5-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester, (1S,4S)- |
| tert-butyl (1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate |