adociaquinone B structure
|
Common Name | adociaquinone B | ||
|---|---|---|---|---|
| CAS Number | 113831-00-8 | Molecular Weight | 423.43800 | |
| Density | 1.61g/cm3 | Boiling Point | 741.7ºC at 760 mmHg | |
| Molecular Formula | C22H17NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 402.3ºC | |
| Name | adociaquinone B |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 741.7ºC at 760 mmHg |
| Molecular Formula | C22H17NO6S |
| Molecular Weight | 423.43800 |
| Flash Point | 402.3ºC |
| Exact Mass | 423.07800 |
| PSA | 118.90000 |
| LogP | 3.48450 |
| Vapour Pressure | 7.25E-22mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | KJMXEMKLXNMFIG-UHFFFAOYSA-N |
| SMILES | CC12CCCc3coc(c31)C(=O)c1cc3c(cc12)C(=O)C1=C(NCCS1(=O)=O)C3=O |
|
~%
adociaquinone B CAS#:113831-00-8 |
| Literature: Schmitz; Bloor Journal of Organic Chemistry, 1988 , vol. 53, # 17 p. 3922 - 3925 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1H,6H-Furo[4',3',2':8,9]phenanthro[2,3-g][1,4]benzothiazine-6,8,13(9H,14bH)-trione,2,3,10,11-tetrahydro-14b-methyl-,12,12-dioxide,(+) |
| AdociaquinoneB |
| 14b-methyl-2,3,10,11-tetrahydro-1h,6h-furo[4',3',2':4,5]tetrapheno[10,9-b][1,4]thiazine-6,8,13(9h,14bh)-trione 12,12-dioxide |