(E)-4-(2,5-dimethoxyphenyl)-2-methylbut-3-en-2-ol structure
|
Common Name | (E)-4-(2,5-dimethoxyphenyl)-2-methylbut-3-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 113949-26-1 | Molecular Weight | 222.28000 | |
| Density | 1.063g/cm3 | Boiling Point | 366.3ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | (E)-4-(2,5-dimethoxyphenyl)-2-methylbut-3-en-2-ol |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 366.3ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 175.3ºC |
| Exact Mass | 222.12600 |
| PSA | 38.69000 |
| LogP | 2.48790 |
| Vapour Pressure | 5.22E-06mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | PUJHCKKUPWVCBP-BQYQJAHWSA-N |
| SMILES | COc1ccc(OC)c(C=CC(C)(C)O)c1 |
|
~%
(E)-4-(2,5-dime... CAS#:113949-26-1 |
| Literature: Pandey, G.; Krishna, A. Journal of Organic Chemistry, 1988 , vol. 53, # 10 p. 2364 - 2365 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |