(E)-4-[(2,5-dimethoxyphenyl)amino]pent-3-en-2-one structure
|
Common Name | (E)-4-[(2,5-dimethoxyphenyl)amino]pent-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 58867-99-5 | Molecular Weight | 235.27900 | |
| Density | 1.102g/cm3 | Boiling Point | 375.2ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.7ºC | |
| Name | (E)-4-(2,5-dimethoxyanilino)pent-3-en-2-one |
|---|
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 375.2ºC at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 180.7ºC |
| Exact Mass | 235.12100 |
| PSA | 47.56000 |
| LogP | 2.68150 |
| Index of Refraction | 1.546 |
| InChIKey | LEGOTNOJKXVSJS-VQHVLOKHSA-N |
| SMILES | COc1ccc(OC)c(NC(C)=CC(C)=O)c1 |
|
~%
(E)-4-[(2,5-dim... CAS#:58867-99-5 |
| Literature: Lions; Perkin; Robinson Journal of the Chemical Society, 1925 , vol. 127, p. 1167 |
|
~%
(E)-4-[(2,5-dim... CAS#:58867-99-5 |
| Literature: Lions; Perkin; Robinson Journal of the Chemical Society, 1925 , vol. 127, p. 1167 |