Licochalcone A structure
|
Common Name | Licochalcone A | ||
|---|---|---|---|---|
| CAS Number | 58749-22-7 | Molecular Weight | 338.397 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O4 | Melting Point | 100° | |
| MSDS | N/A | Flash Point | 186.9±23.6 °C | |
Use of Licochalcone ALicochalcone A, a flavonoid isolated from the famous Chinese medicinal herb Glycyrrhiza uralensis Fisch, presents obvious anti-cancer effects. The IC50 value is 0.97 μM for UGT1A1. |
| Name | (E)-3-[4-hydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Licochalcone A, a flavonoid isolated from the famous Chinese medicinal herb Glycyrrhiza uralensis Fisch, presents obvious anti-cancer effects. The IC50 value is 0.97 μM for UGT1A1. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.6±50.0 °C at 760 mmHg |
| Melting Point | 100° |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.397 |
| Flash Point | 186.9±23.6 °C |
| Exact Mass | 338.151794 |
| PSA | 66.76000 |
| LogP | 4.95 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | KAZSKMJFUPEHHW-DHZHZOJOSA-N |
| SMILES | C=CC(C)(C)c1cc(C=CC(=O)c2ccc(O)cc2)c(OC)cc1O |
| Storage condition | ?20°C |
| (E)-3-[5-(1,1-Dimethyl-2-propenyl)-4-hydroxy-2-methoxyphenyl]-1-(4-hydroxyphenyl)-2-propen-1-one |
| Licochalcone A |
| (2E)-3-[5-(1,1-dimethyl-2-propenyl)-4-hydroxy-2-methoxyphenyl]-1-(4-hdyroxyphenyl)-2-propen-1-one |
| LicochalconeA |
| LICOAGROCHACONE A |
| (2E)-3-[4-Hydroxy-2-methoxy-5-(2-methyl-3-buten-2-yl)phenyl]-1-(4-hydroxyphenyl)-2-propen-1-one |
| 2-Propen-1-one,3-(5-(1,1-dimethyl-2-propenyl)-4-hydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-,(E) |
| (2E)-3-[4-Hydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| Licochalcone-A,Synthetic |
| 5-(1,1-dimethylallyl)-4,4'-dihydroxy-2-methoxychalcone |
| (2E)-3-[5-(1,1-dimethylprop-2-en-1-yl)-4-hydroxy-2-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| 3-Dimethylallyl-4,4'-dihydroxy-6-methoxychalcone |
| 2-Propen-1-one, 3-[5-(1,1-dimethyl-2-propen-1-yl)-4-hydroxy-2-methoxyphenyl]-1-(4-hydroxyphenyl)-, (2E)- |