Diethyl (4-methoxybenzyl)phosphonate structure
|
Common Name | Diethyl (4-methoxybenzyl)phosphonate | ||
|---|---|---|---|---|
| CAS Number | 1145-93-3 | Molecular Weight | 258.251 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 363.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H19O4P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 187.5±43.5 °C | |
| Name | Diethyl (4-Methoxybenzyl)phosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.8±25.0 °C at 760 mmHg |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.251 |
| Flash Point | 187.5±43.5 °C |
| Exact Mass | 258.102081 |
| PSA | 54.57000 |
| LogP | 1.98 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | NKARVHNAACNYGE-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(OC)cc1)OCC |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-(diethoxyphosphorylmethyl)-4-methoxybenzene |
| 4-(Diethylphosphonomethyl)anisole |
| EINECS 214-548-5 |
| (4-Methoxybenzyl)phosphonic Acid Diethyl Ester |
| Phosphonic acid, P-[(4-methoxyphenyl)methyl]-, diethyl ester |
| Diethyl 4-methoxybenzylphosphonate |
| MFCD00015662 |
| Diethyl (4-methoxybenzyl)phosphonate |