Diethyl (4-Cyanobenzyl)phosphonate structure
|
Common Name | Diethyl (4-Cyanobenzyl)phosphonate | ||
|---|---|---|---|---|
| CAS Number | 1552-41-6 | Molecular Weight | 253.23400 | |
| Density | 1.14g/cm3 | Boiling Point | 169ºC | |
| Molecular Formula | C12H16NO3P | Melting Point | 31ºC | |
| MSDS | N/A | Flash Point | 192ºC | |
| Name | Diethyl (4-Cyanobenzyl)phosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 169ºC |
| Melting Point | 31ºC |
| Molecular Formula | C12H16NO3P |
| Molecular Weight | 253.23400 |
| Flash Point | 192ºC |
| Exact Mass | 253.08700 |
| PSA | 69.13000 |
| LogP | 3.32438 |
| Vapour Pressure | 2.07E-06mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | MFXWOYIWKNJHPC-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(C#N)cc1)OCC |
| Storage condition | 0-10°C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (4-Cyanobenzyl)phosphonic Acid Diethyl Ester |
| 4-(Diethylphosphonomethyl)benzonitrile |
| 4-(diethoxyphosphorylmethyl)benzonitrile |