Apaziquone structure
|
Common Name | Apaziquone | ||
|---|---|---|---|---|
| CAS Number | 114560-48-4 | Molecular Weight | 288.298 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 632.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.2±31.5 °C | |
Use of ApaziquoneApaziquone (EO-9), an analog of Mitomycin C, is a prodrug that is activated to DNA damaging species by oxidoreductases (particularly NQO1). Apaziquone has the ability to kill aerobic and/or hypoxic cancer cells. Apaziquone, a bioreductive alkylating agent, inhibits cell proliferation and induces apoptosis in oral squamous cell carcinoma (OSCC) cells. Apaziquone significantly reduces oral tumor xenograft volume in immunocompromised NOD/SCID/Crl mice[1][2]. |
| Name | 5-(aziridin-1-yl)-3-(hydroxymethyl)-2-[(E)-3-hydroxyprop-1-enyl]-1-methylindole-4,7-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Apaziquone (EO-9), an analog of Mitomycin C, is a prodrug that is activated to DNA damaging species by oxidoreductases (particularly NQO1). Apaziquone has the ability to kill aerobic and/or hypoxic cancer cells. Apaziquone, a bioreductive alkylating agent, inhibits cell proliferation and induces apoptosis in oral squamous cell carcinoma (OSCC) cells. Apaziquone significantly reduces oral tumor xenograft volume in immunocompromised NOD/SCID/Crl mice[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 632.3±55.0 °C at 760 mmHg |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.298 |
| Flash Point | 336.2±31.5 °C |
| Exact Mass | 288.110992 |
| PSA | 82.54000 |
| LogP | -1.36 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | MXPOCMVWFLDDLZ-NSCUHMNNSA-N |
| SMILES | Cn1c(C=CCO)c(CO)c2c1C(=O)C=C(N1CC1)C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
Apaziquone CAS#:114560-48-4 |
| Literature: Synthesis, , # 5 p. 633 - 636 |
| Neoquin |
| NOR-701 |
| 1H-Indole-4,7-dione, 5-(1-aziridinyl)-3-(hydroxymethyl)-2-(3-hydroxy-1-propen-1-yl)-1-methyl- |
| EO-9 |
| 5-(1-Aziridinyl)-3-(hydroxymethyl)-2-(3-hydroxy-1-propen-1-yl)-1-methyl-1H-indole-4,7-dione |
| Apaziquonum |
| Apaziquone |
| EOquin |