butyl 2-[bis(4-hydroxyphenyl)methyl]benzoate structure
|
Common Name | butyl 2-[bis(4-hydroxyphenyl)methyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 114626-60-7 | Molecular Weight | 376.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl 2-[bis(4-hydroxyphenyl)methyl]benzoate |
|---|
| Molecular Formula | C24H24O4 |
|---|---|
| Molecular Weight | 376.44500 |
| Exact Mass | 376.16700 |
| PSA | 66.76000 |
| LogP | 5.23490 |
| InChIKey | YAGIZCHVEGQUPE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
|
~%
butyl 2-[bis(4-... CAS#:114626-60-7 |
| Literature: Davis; Schuhmann Journal of Research of the National Bureau of Standards (United States), 1947 , vol. 39, p. 238 Chem.Abstr., 1948 , p. 2848 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |