ethyl 2-[bis(4-hydroxyphenyl)methyl]benzoate structure
|
Common Name | ethyl 2-[bis(4-hydroxyphenyl)methyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 63450-78-2 | Molecular Weight | 348.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4,4'-dihydroxy-benzhydryl)-benzoic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H20O4 |
|---|---|
| Molecular Weight | 348.39200 |
| Exact Mass | 348.13600 |
| PSA | 66.76000 |
| LogP | 4.45470 |
| InChIKey | ICEYQDSJXDMZGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
| HS Code | 2918290000 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2-(4,4'-Dihydroxy-benzhydryl)-benzoesaeure-aethylester |
| ethyl 2-(bis(4-hydroxyphenyl)methyl)benzoate |