1-(2-Chloro-4-nitrophenyl)piperazine structure
|
Common Name | 1-(2-Chloro-4-nitrophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 114878-60-3 | Molecular Weight | 241.67400 | |
| Density | 1.331g/cm3 | Boiling Point | 411ºC at 760mmHg | |
| Molecular Formula | C10H12ClN3O2 | Melting Point | 105ºC | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 1-(2-Chloro-4-nitrophenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760mmHg |
| Melting Point | 105ºC |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.67400 |
| Flash Point | 202.4ºC |
| Exact Mass | 241.06200 |
| PSA | 61.09000 |
| LogP | 2.57480 |
| Vapour Pressure | 5.78E-07mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | JNUWBYPJOBSXDN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCNCC2)c(Cl)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933599090 |
|
~85%
1-(2-Chloro-4-n... CAS#:114878-60-3 |
| Literature: The University of Hong Kong Patent: US2011/212975 A1, 2011 ; Location in patent: Page/Page column 13; 18 ; |
|
~%
1-(2-Chloro-4-n... CAS#:114878-60-3 |
| Literature: US4797401 A1, ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00640776 |
| 1-(2-Chloro-4-Nitrophenyl)Piperazine |