7,10-di-Troc-Docetaxel
7,10-di-Troc-Docetaxel structure
|
Common Name | 7,10-di-Troc-Docetaxel | ||
|---|---|---|---|---|
| CAS Number | 114915-14-9 | Molecular Weight | 807.879 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 900.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C43H53NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 498.4±34.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,10-O-Ditroc docetaxel |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 900.5±65.0 °C at 760 mmHg |
| Molecular Formula | C43H53NO14 |
| Molecular Weight | 807.879 |
| Flash Point | 498.4±34.3 °C |
| Exact Mass | 807.346619 |
| PSA | 224.45000 |
| LogP | 6.55 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | QTCVMFMWHTVJTQ-CLXVTHCMSA-N |
| SMILES | CC(=O)OC12COC1CC(OC(=O)OCC(Cl)(Cl)Cl)C1(C)C(=O)C(OC(=O)OCC(Cl)(Cl)Cl)C3=C(C)C(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |
| Storage condition | 2~8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 2 | |
![13-[(2'R,4'S,5'R)-3'-t-butoxycarbonyl-2'-(1'''-naphthyl)-4'-phenyl-1,3-oxazolidine-5-carbonyl]-7,10-(di-2'',2'',2''-trichloroethoxy carbonyl)-10-deacetylbaccatin III Structure](https://image.chemsrc.com/caspic/001/1033962-64-9.png)
CAS#:1033962-64-9
CAS#:24424-99-5![N-Des-t-boc-10-deacetyl-7,10-O-bis{[(2,2,2-trichloroethyl)oxy]carbonyl} Docetaxel Structure](https://image.chemsrc.com/caspic/353/114915-16-1.png)
CAS#:114915-16-1
CAS#:859498-31-0
CAS#:174729-13-6
CAS#:73210-14-7
CAS#:144787-20-2
CAS#:100-52-7
CAS#:78432-77-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (5β,7β,10β,13α)-4-Acetoxy-13-({(2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoyl}oxy)-1,7,10-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| (2α,5β,7β,10β,13α)-4-Acetoxy-1,7,10-trihydroxy-13-{[(2R,3S)-2-hydroxy-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoyl]oxy}-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| 4-acetoxy-2-phenyl-2H-1-chromene |
| Docetaxel |
| 10-deacetyl-7,10-diTroc-baccatin III |
| (2α,5β,7β,10β,13α)-4-Acetoxy-13-({(2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoyl}oxy)-1,7,10-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| N-debenzoyl-N-Boc-10-deacetyl taxol |
| Docetaxel intermediate |
| (2α,5β,7β,10β,13α)-4-(acetyloxy)-13-({(2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoyl}oxy)-1,7,10-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| N-debenzoyl-N-tert-butoxycarbonyl-10-deacetyl taxol |
| Docetaxol |
| 2H-1-Benzopyran-4-ol,2-phenyl-,acetate |
| 4-acetoxy-2-phenyl-2H-chromene |
| Taxotere |
| 7,10-di-Troc-Docetaxel |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 7,10-O-Ditroc docetaxel? |
| A: Related downstream products(CAS) of 7,10-O-Ditroc docetaxel: 78432-77-6;114915-16-1. |
| Q: What is the LogP of 7,10-O-Ditroc docetaxel? |
| A: LogP of 7,10-O-Ditroc docetaxel is 6.55. |
| Q: What is the molecular weight of 7,10-O-Ditroc docetaxel? |
| A: Molecular weight of 7,10-O-Ditroc docetaxel is 807.879. |
| Q: What is the polar surface area (PSA) of 7,10-O-Ditroc docetaxel? |
| A: Polar surface area (PSA) of 7,10-O-Ditroc docetaxel is 224.45000. |
| Q: What is the SMILES notation of 7,10-O-Ditroc docetaxel? |
| A: SMILES notation of 7,10-O-Ditroc docetaxel is CC(=O)OC12COC1CC(OC(=O)OCC(Cl)(Cl)Cl)C1(C)C(=O)C(OC(=O)OCC(Cl)(Cl)Cl)C3=C(C)C(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C. |
| Q: What is the boiling point of 7,10-O-Ditroc docetaxel? |
| A: Boiling point of 7,10-O-Ditroc docetaxel is 900.5±65.0 °C at 760 mmHg. |
| Q: What is the molecular formula of 7,10-O-Ditroc docetaxel? |
| A: Molecular formula of 7,10-O-Ditroc docetaxel is C43H53NO14. |
| Q: What is the CAS number of 7,10-O-Ditroc docetaxel? |
| A: CAS number of 7,10-O-Ditroc docetaxel is 114915-14-9. |
| Q: What is the English name of 7,10-O-Ditroc docetaxel? |
| A: The English name of 7,10-O-Ditroc docetaxel is 7,10-O-Ditroc docetaxel. |
| Q: What are the storage conditions for 7,10-O-Ditroc docetaxel? |
| A: Storage conditions for 7,10-O-Ditroc docetaxel: 2~8°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |