3-[4-(trifluoromethyl)phenyl]prop-2-enamide
![3-[4-(trifluoromethyl)phenyl]prop-2-enamide Structure](https://image.chemsrc.com/caspic/330/115093-99-7.png)
3-[4-(trifluoromethyl)phenyl]prop-2-enamide structure
|
Common Name | 3-[4-(trifluoromethyl)phenyl]prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 115093-99-7 | Molecular Weight | 215.17200 | |
| Density | 1.182g/cm3 | Boiling Point | 149.6ºC at 760mmHg | |
| Molecular Formula | C10H8F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 55ºC | |
| Name | 3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 149.6ºC at 760mmHg |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17200 |
| Flash Point | 55ºC |
| Exact Mass | 215.05600 |
| PSA | 43.09000 |
| LogP | 2.90420 |
| Vapour Pressure | 0.000112mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | BPRFEFAHXYCKRO-ZZXKWVIFSA-N |
| SMILES | NC(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
|
~92%
3-[4-(trifluoro... CAS#:115093-99-7 |
| Literature: Ikemoto, Tomomi; Ito, Tatsuya; Tomimatsu, Kiminori; Sawai, Yasuhiro; Nishiyama, Hirohiko; Isogami, Yasushi Patent: US2003/69419 A1, 2003 ; |
|
~%
3-[4-(trifluoro... CAS#:115093-99-7 |
| Literature: EP1350792 A1, ; Page/Page column 29 ; |
|
~%
3-[4-(trifluoro... CAS#:115093-99-7
3-[4-(trifluoro... CAS#:115093-99-7 |
| Literature: Journal of Chemical Research, , # 7 p. 382 - 384 |
|
3-[4-(trifluoro... CAS#:115093-99-7 ~%
3-[4-(trifluoro... CAS#:115093-99-7 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 18 p. 553 - 561 |
![3-[4-(trifluoromethyl)phenyl]-2-propenoylhloride structure](https://image.chemsrc.com/caspic/086/105919-36-6.png)
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |