(4-methoxyphenyl)-(4-nitrophenyl)methanone structure
|
Common Name | (4-methoxyphenyl)-(4-nitrophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1151-94-6 | Molecular Weight | 257.24100 | |
| Density | 1.264g/cm3 | Boiling Point | 435.3ºC at 760 mmHg | |
| Molecular Formula | C14H11NO4 | Melting Point | 125-127ºC | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | (4-methoxyphenyl)-(4-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 435.3ºC at 760 mmHg |
| Melting Point | 125-127ºC |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24100 |
| Flash Point | 197.9ºC |
| Exact Mass | 257.06900 |
| PSA | 72.12000 |
| LogP | 3.35760 |
| Index of Refraction | 1.596 |
| InChIKey | DXVSAELNVPXMSQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00178348 |
| 4-Methoxyphenyl-4-nitrophenyl ketone |
| 4-(4-Nitrobenzoyl)-anisole |
| 4-(4-methoxybenzoyl)-nitrobenzene |
| (4-methoxyphenyl)(4-nitrophenyl)methanone |
| (4-METHOXY-PHENYL)-(4-NITRO-PHENYL)-METHANONE |
| 4-nitro-4'-methoxybenzophenone |
| 4-Methoxy-4'-nitrobenzophenone |