1,5-Dichloro-2-methyl-4-(trifluoromethyl)benzene structure
|
Common Name | 1,5-Dichloro-2-methyl-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 115571-61-4 | Molecular Weight | 229.027 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 212.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5Cl2F3 | Melting Point | 136-140 | |
| MSDS | N/A | Flash Point | 94.7±19.4 °C | |
| Name | 1,5-dichloro-2-methyl-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 212.9±35.0 °C at 760 mmHg |
| Melting Point | 136-140 |
| Molecular Formula | C8H5Cl2F3 |
| Molecular Weight | 229.027 |
| Flash Point | 94.7±19.4 °C |
| Exact Mass | 227.972046 |
| LogP | 4.66 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | IEODOJMCKLXBMU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(F)(F)F)c(Cl)cc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2903999090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-trifluoromethyl-4,6-dichlorotoluene |
| 2,4-dichloro-5-methyl-benzotrifuoride |
| Benzene, 1,5-dichloro-2-methyl-4-(trifluoromethyl)- |
| 2,4-dichloro-5-methyl-1-(trifluoromethyl)benzene |
| 2,4,5-TRIAMINO-6-HYDROXY PYRIMIDINE DIHYDROCHLORIDE |
| 1,5-Dichloro-2-methyl-4-(trifluoromethyl)benzene |
| 2,4-Dichloro-5-methylbenzotrifluoride |
| 2,4-Dichloro-5-trifluoromethyltoluene |
| MFCD00190113 |
| Benzene,1,5-dichloro-2-methyl-4-(trifluoromethyl) |