3,4-Dichloro-2-nitro-6-(trifluoromethyl)toluene structure
|
Common Name | 3,4-Dichloro-2-nitro-6-(trifluoromethyl)toluene | ||
|---|---|---|---|---|
| CAS Number | 115571-66-9 | Molecular Weight | 274.024 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 255.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4Cl2F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.5±25.9 °C | |
| Name | 3,4-Dichloro-2-nitro-6-(trifluoromethyl)toluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 255.8±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4Cl2F3NO2 |
| Molecular Weight | 274.024 |
| Flash Point | 108.5±25.9 °C |
| Exact Mass | 272.957123 |
| PSA | 45.82000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | IBRWCYHTODRXJR-UHFFFAOYSA-N |
| SMILES | Cc1c(C(F)(F)F)cc(Cl)c(Cl)c1[N+](=O)[O-] |
| Hazard Codes | T: Toxic;Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4-Dichloro-2-Nitro-6-(Trifluoromethyl)Toluene |
| 1,2-Dichloro-4-methyl-3-nitro-5-(trifluoromethyl)benzene |
| Benzene, 1,2-dichloro-4-methyl-3-nitro-5-(trifluoromethyl)- |
| MFCD04972788 |