4,4',4''-Trimethyltriphenylamine structure
|
Common Name | 4,4',4''-Trimethyltriphenylamine | ||
|---|---|---|---|---|
| CAS Number | 1159-53-1 | Molecular Weight | 287.398 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 170 °C / 0.1 mmHg (527.2182 °C / 760 mmHg) | |
| Molecular Formula | C21H21N | Melting Point | 114-118°C | |
| MSDS | Chinese USA | Flash Point | 172.9±22.9 °C | |
| Name | 4,4,4-Trimethyltriphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 170 °C / 0.1 mmHg (527.2182 °C / 760 mmHg) |
| Melting Point | 114-118°C |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.398 |
| Flash Point | 172.9±22.9 °C |
| Exact Mass | 287.167389 |
| PSA | 142.07000 |
| LogP | 0.86 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.821 |
| InChIKey | YXYUIABODWXVIK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | T;N,N,T,Xn,F |
|---|---|
| Risk Phrases | R25:Toxic if swallowed. R50/53:Very Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment . R36:Irritating to the eyes. R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R11:Highly Flammable. |
| Safety Phrases | S22-S37-S45-S60-S61-S36-S26-S16 |
| RIDADR | UN 2811 |
| RTECS | EZ9100000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2921499090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00674043 |
| 4-methyl-N,N-bis(4-methylphenyl)aniline |
| 4,4′,4-Trimethyltriphenylamine |
| 4,4',4''-Trimethyltriphenylamine |
| Tri-p-tolylaMine |
| EINECS 214-595-1 |
| 4-Methyl-N,N-bis(4-methylphenyl)aniline |
| Benzenamine, 4-methyl-N,N-bis(4-methylphenyl)- |
| tri(p-tolyl)amine |