Hexachloroacetone structure
|
Common Name | Hexachloroacetone | ||
|---|---|---|---|---|
| CAS Number | 116-16-5 | Molecular Weight | 264.75000 | |
| Density | 1.743 g/mL at 25 °C(lit.) | Boiling Point | 66-70 °C6 mm Hg(lit.) | |
| Molecular Formula | C3Cl6O | Melting Point | -3 °C | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | hexachloroacetone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.743 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 66-70 °C6 mm Hg(lit.) |
| Melting Point | -3 °C |
| Molecular Formula | C3Cl6O |
| Molecular Weight | 264.75000 |
| Flash Point | >230 °F |
| Exact Mass | 261.80800 |
| PSA | 17.07000 |
| LogP | 3.29590 |
| Vapour Pressure | 0.284mmHg at 25°C |
| Index of Refraction | n20/D 1.511(lit.) |
| InChIKey | DOJXGHGHTWFZHK-UHFFFAOYSA-N |
| SMILES | O=C(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| Water Solubility | SLIGHTLY SOLUBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H317-H331-H411 |
| Precautionary Statements | P261-P280-P301 + P312 + P330-P304 + P340 + P312-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R51/53 |
| Safety Phrases | S24/25-S61 |
| RIDADR | UN 2661 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | UC2100000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2914700014 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700014 |
|---|---|
| Summary | 2914700014 1,1,1,3,3,3-hexachloropropan-2-one。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:5.5%。general tariff:30.0% |
|
Hydroxycarboxylic acid receptors are essential for breast cancer cells to control their lipid/fatty acid metabolism.
Oncotarget 6 , 19706-20, (2015) Cancer cells exhibit characteristic changes in their metabolism with efforts being made to address them therapeutically. However, targeting metabolic enzymes as such is a major challenge due to their ... |
|
|
Coumarins as new matrices for matrix-assisted laser-desorption/ionization Fourier transform ion cyclotron resonance mass spectrometric analysis of hydrophobic compounds.
Anal. Chim. Acta 882 , 49-57, (2015) Hydrophobic compounds with hydroxyl, aldehyde or ketone groups are generally difficult to detect using matrix-assisted laser desorption/ionization mass spectrometry (MALDI-MS), because these compounds... |
|
|
Integrated metabolomic and proteomic analysis reveals systemic responses of Rubrivivax benzoatilyticus JA2 to aniline stress.
J. Proteome Res. 14(2) , 711-27, (2015) Aromatic amines are widely distributed in the environment and are major environmental pollutants. Although degradation of aromatic amines is well studied in bacteria, physiological adaptations and str... |
| Perchloroacetone |
| EINECS 204-129-5 |
| Hexachloroacetone |
| Hexachloro-2-propanone |
| HCA |
| 1,1,1,3,3,3-hexachloropropan-2-one |
| MFCD00000796 |
| 1,1,1,3,3,3-hexachloro-2-propanone |