bis[ethynyl(dimethyl)silyl]-dimethylsilane
![bis[ethynyl(dimethyl)silyl]-dimethylsilane Structure](https://image.chemsrc.com/caspic/343/116161-01-4.png)
bis[ethynyl(dimethyl)silyl]-dimethylsilane structure
|
Common Name | bis[ethynyl(dimethyl)silyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 116161-01-4 | Molecular Weight | 224.52200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis[ethynyl(dimethyl)silyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H20Si3 |
|---|---|
| Molecular Weight | 224.52200 |
| Exact Mass | 224.08700 |
| LogP | 2.61320 |
| InChIKey | OWLFEQWAPYOAMR-UHFFFAOYSA-N |
| SMILES | C#C[Si](C)(C)[Si](C)(C)[Si](C)(C)C#C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis[ethynyl(dim... CAS#:116161-01-4 |
| Literature: Organometallics, , vol. 29, # 22 p. 5897 - 5903 |
|
~%
bis[ethynyl(dim... CAS#:116161-01-4 |
| Literature: Chemistry Letters, , p. 1149 - 1152 |
![bis[chloro(dimethyl)silyl]-dimethylsilane structure](https://image.chemsrc.com/caspic/036/812-36-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-diethynylhexamethyltrisilane |
| Trisilane,1,3-diethynyl-1,1,2,2,3,3-hexamethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does bis[ethynyl(dimethyl)silyl]-dimethylsilane have? |
| A: English synonyms of bis[ethynyl(dimethyl)silyl]-dimethylsilane: 1,3-diethynylhexamethyltrisilane, Trisilane,1,3-diethynyl-1,1,2,2,3,3-hexamethyl. |
| Q: What is the LogP of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: LogP of bis[ethynyl(dimethyl)silyl]-dimethylsilane is 2.61320. |
| Q: What is the molecular formula of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: Molecular formula of bis[ethynyl(dimethyl)silyl]-dimethylsilane is C10H20Si3. |
| Q: What is the molecular weight of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: Molecular weight of bis[ethynyl(dimethyl)silyl]-dimethylsilane is 224.52200. |
| Q: What is the SMILES notation of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: SMILES notation of bis[ethynyl(dimethyl)silyl]-dimethylsilane is C#C[Si](C)(C)[Si](C)(C)[Si](C)(C)C#C. |
| Q: What is the InChIKey of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: InChIKey of bis[ethynyl(dimethyl)silyl]-dimethylsilane is OWLFEQWAPYOAMR-UHFFFAOYSA-N. |
| Q: What are the upstream materials of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: Related upstream materials(CAS) of bis[ethynyl(dimethyl)silyl]-dimethylsilane: 3704-44-7;812-36-2;4301-14-8. |
| Q: What is the English name of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: The English name of bis[ethynyl(dimethyl)silyl]-dimethylsilane is bis[ethynyl(dimethyl)silyl]-dimethylsilane. |
| Q: What is the Chinese name of 116161-01-4? |
| A: Chinese name of 116161-01-4 is 116161-01-4. |
| Q: What is the CAS number of bis[ethynyl(dimethyl)silyl]-dimethylsilane? |
| A: CAS number of bis[ethynyl(dimethyl)silyl]-dimethylsilane is 116161-01-4. |