1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine
![1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine Structure](https://image.chemsrc.com/caspic/351/116409-04-2.png)
1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine structure
|
Common Name | 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 116409-04-2 | Molecular Weight | 427.49000 | |
| Density | 1.228g/cm3 | Boiling Point | 512.5ºC at 760mmHg | |
| Molecular Formula | C24H29NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
Summary: 1-[7-Methyl-8-(3,4,5-Trimethoxyphenyl)-7,8-Dihydro-6H-[1,3]Dioxolo[4,5-g]Chromen-6-yl]Pyrrolidine (CAS号：116409-04-2，molecular formula：C24H29NO6，molecular weight：427.49000) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 512.5ºC at 760mmHg |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.49000 |
| Flash Point | 140.8ºC |
| Exact Mass | 427.19900 |
| PSA | 58.62000 |
| LogP | 3.96130 |
| Vapour Pressure | 1.29E-10mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | LRLXUQCQYHLPOQ-UHFFFAOYSA-N |
| SMILES | COc1cc(C2c3cc4c(cc3OC(N3CCCC3)C2C)OCO4)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
1-[7-methyl-8-(... CAS#:116409-04-2 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
|
~%
1-[7-methyl-8-(... CAS#:116409-04-2 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
|
~%
1-[7-methyl-8-(... CAS#:116409-04-2 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
![7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol structure](https://image.chemsrc.com/caspic/313/116409-05-3.png)
CAS#:116409-05-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Growth inhibition of human SK-MEL-2 cells
Source: ChEMBL
Target: SK-MEL-2
External Id: CHEMBL4700303
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: Related upstream materials(CAS) of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine: 123-38-6;116409-29-1;533-31-3;86-81-7. |
| Q: What is the SMILES notation of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: SMILES notation of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is COc1cc(C2c3cc4c(cc3OC(N3CCCC3)C2C)OCO4)cc(OC)c1OC. |
| Q: What is the polar surface area (PSA) of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: Polar surface area (PSA) of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is 58.62000. |
| Q: What is the LogP of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: LogP of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is 3.96130. |
| Q: What is the Chinese name of 116409-04-2? |
| A: Chinese name of 116409-04-2 is 116409-04-2. |
| Q: What is the CAS number of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: CAS number of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is 116409-04-2. |
| Q: What is the molecular weight of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: Molecular weight of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is 427.49000. |
| Q: What is the InChIKey of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: InChIKey of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is LRLXUQCQYHLPOQ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: The English name of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine. |
| Q: What is the boiling point of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine? |
| A: Boiling point of 1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine is 512.5ºC at 760mmHg. |