7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol
![7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol Structure](https://image.chemsrc.com/caspic/313/116409-05-3.png)
7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol structure
|
Common Name | 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol | ||
|---|---|---|---|---|
| CAS Number | 116409-05-3 | Molecular Weight | 374.38400 | |
| Density | 1.283g/cm3 | Boiling Point | 490.6ºC at 760mmHg | |
| Molecular Formula | C20H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.5ºC | |
Summary: 7-Methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol (CAS: 116409-05-3), molecular formula C20H22O7, molecular weight 374.38400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 490.6ºC at 760mmHg |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.38400 |
| Flash Point | 250.5ºC |
| Exact Mass | 374.13700 |
| PSA | 75.61000 |
| LogP | 2.91990 |
| Vapour Pressure | 1.93E-10mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | RBDOZECECGJHSC-UHFFFAOYSA-N |
| SMILES | COc1cc(C2c3cc4c(cc3OC(O)C2C)OCO4)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
7-methyl-8-(3,4... CAS#:116409-05-3 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
|
~%
7-methyl-8-(3,4... CAS#:116409-05-3 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
|
~%
7-methyl-8-(3,4... CAS#:116409-05-3 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
|
~%
7-methyl-8-(3,4... CAS#:116409-05-3 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 1 p. 89 - 96 |
![1-[7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidine structure](https://image.chemsrc.com/caspic/351/116409-04-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: SMILES notation of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is COc1cc(C2c3cc4c(cc3OC(O)C2C)OCO4)cc(OC)c1OC. |
| Q: What is the English name of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: The English name of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol. |
| Q: What are the upstream materials of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: Related upstream materials(CAS) of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol: 116409-04-2;533-31-3;86-81-7;116409-29-1. |
| Q: What is the molecular weight of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: Molecular weight of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is 374.38400. |
| Q: What is the Chinese name of 116409-05-3? |
| A: Chinese name of 116409-05-3 is 116409-05-3. |
| Q: What is the molecular formula of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: Molecular formula of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is C20H22O7. |
| Q: What is the CAS number of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: CAS number of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is 116409-05-3. |
| Q: What is the polar surface area (PSA) of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: Polar surface area (PSA) of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is 75.61000. |
| Q: What is the InChIKey of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: InChIKey of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is RBDOZECECGJHSC-UHFFFAOYSA-N. |
| Q: What is the boiling point of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol? |
| A: Boiling point of 7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol is 490.6ºC at 760mmHg. |