3,6-diheptoxybenzene-1,2-dicarbonitrile structure
|
Common Name | 3,6-diheptoxybenzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 116453-85-1 | Molecular Weight | 356.50200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-diheptoxybenzene-1,2-dicarbonitrile |
|---|
| Molecular Formula | C22H32N2O2 |
|---|---|
| Molecular Weight | 356.50200 |
| Exact Mass | 356.24600 |
| PSA | 66.04000 |
| LogP | 6.12836 |
| InChIKey | MWWWSCBMIMDNLU-UHFFFAOYSA-N |
| SMILES | CCCCCCCOc1ccc(OCCCCCCC)c(C#N)c1C#N |
|
~85%
3,6-diheptoxybe... CAS#:116453-85-1 |
| Literature: Lo, Pui-Chi; Cheng, Diana Y. Y.; Ng, Dennis K. P. Synthesis, 2005 , # 7 art. no. F17104SS, p. 1141 - 1147 |
|
~52%
3,6-diheptoxybe... CAS#:116453-85-1 |
| Literature: Cook, Michael J.; Dunn, Adrian J.; Howe, Steven D.; Thomson, Andrew J.; Harrison, Kenneth J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2453 - 2458 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |