2-Amino-4-bromo-6-nitrobenzoic acid structure
|
Common Name | 2-Amino-4-bromo-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1167056-67-8 | Molecular Weight | 261.030 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 430.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.0±28.7 °C | |
| Name | 2-amino-4-bromo-6-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.3±45.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrN2O4 |
| Molecular Weight | 261.030 |
| Flash Point | 214.0±28.7 °C |
| Exact Mass | 259.943268 |
| PSA | 109.14000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | LVSDQVYGRCBVCK-UHFFFAOYSA-N |
| SMILES | Nc1cc(Br)cc([N+](=O)[O-])c1C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 2-amino-4-bromo-6-nitro- |
| 2-Amino-4-bromo-6-nitrobenzoic acid |