2-Amino-4-bromo-6-nitrophenol structure
|
Common Name | 2-Amino-4-bromo-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 139138-08-2 | Molecular Weight | 233.01900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-4-bromo-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H5BrN2O3 |
|---|---|
| Molecular Weight | 233.01900 |
| Exact Mass | 231.94800 |
| PSA | 92.07000 |
| LogP | 2.74950 |
| InChIKey | SAOMJFDQNMQPJJ-UHFFFAOYSA-N |
| SMILES | Nc1cc(Br)cc([N+](=O)[O-])c1O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-amino-4-bromo-6-nitro-phenol |
| 2-Amino-4-brom-6-nitro-phenol |