Avenanthramide C structure
|
Common Name | Avenanthramide C | ||
|---|---|---|---|---|
| CAS Number | 116764-15-9 | Molecular Weight | 315.27800 | |
| Density | N/A | Boiling Point | 702.3±60.0 °C(Predicted) | |
| Molecular Formula | C16H13NO6 | Melting Point | 248-250 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Avenanthramide CAvenanthramide C inhibits vascular smooth muscle cell proliferation and enhances nitric oxide production. |
| Name | 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 702.3±60.0 °C(Predicted) |
|---|---|
| Melting Point | 248-250 °C |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.27800 |
| Exact Mass | 315.07400 |
| PSA | 130.58000 |
| LogP | 2.80300 |
| InChIKey | IDUUXROOZBOOPH-QHHAFSJGSA-N |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)Nc1ccc(O)cc1C(=O)O |
|
~%
Avenanthramide C CAS#:116764-15-9 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 51, # 3 p. 594 - 600 |
|
~%
Avenanthramide C CAS#:116764-15-9 |
| Literature: Tetrahedron Letters, , vol. 31, # 18 p. 2647 - 2648 |
|
~%
Avenanthramide C CAS#:116764-15-9 |
| Literature: Phytochemistry, , vol. 47, # 6 p. 969 - 974 |
| Avenanthramide 2C |
| UNII-5FRF61BOYU |
| Avenanthramide C |
| Avenanthramide BC |
| BEN802 |