3-Nitro-4-(trifluoromethyl)benzoic acid structure
|
Common Name | 3-Nitro-4-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 116965-16-3 | Molecular Weight | 235.117 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 330.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F3NO4 | Melting Point | 169ºC | |
| MSDS | N/A | Flash Point | 153.4±27.9 °C | |
| Name | 3-Nitro-4-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.0±42.0 °C at 760 mmHg |
| Melting Point | 169ºC |
| Molecular Formula | C8H4F3NO4 |
| Molecular Weight | 235.117 |
| Flash Point | 153.4±27.9 °C |
| Exact Mass | 235.009247 |
| PSA | 83.12000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | NIWGMOJIGTUDFT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(F)(F)F)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2916399090 |
|
~48%
3-Nitro-4-(trif... CAS#:116965-16-3 |
| Literature: Merck and Co., Inc. Patent: US5262412 A1, 1993 ; US 5262412 A |
|
~%
3-Nitro-4-(trif... CAS#:116965-16-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 12 p. 3163 - 3179 |
|
~25%
3-Nitro-4-(trif... CAS#:116965-16-3 |
| Literature: Liebigs Annalen der Chemie, , # 6 p. 569 - 579 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Nitro-4-(trifluoromethyl)benzoic acid |
| MFCD00274359 |
| Benzoic acid, 3-nitro-4-(trifluoromethyl)- |