3-Amino-4-(trifluoromethyl)benzoic acid structure
|
Common Name | 3-Amino-4-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 125483-00-3 | Molecular Weight | 205.134 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 325.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | 203-205ºC | |
| MSDS | N/A | Flash Point | 150.6±27.9 °C | |
| Name | 3-Amino-4-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 325.4±42.0 °C at 760 mmHg |
| Melting Point | 203-205ºC |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.134 |
| Flash Point | 150.6±27.9 °C |
| Exact Mass | 205.035065 |
| PSA | 63.32000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | RVYKHFGOJJKVNB-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)O)ccc1C(F)(F)F |
| Storage condition | 2-8°C |
|
~10%
3-Amino-4-(trif... CAS#:125483-00-3 |
| Literature: Ameriks, Michael K.; Axe, Frank U.; Edwards, James P.; Grice, Cheryl A.; Cai, Hui; Gleason, Elizabeth Ann; Meduna, Steven P.; Tays, Kevin L.; Wiener, John J. M.; Wickboldt, Alvah T. Patent: US2008/200454 A1, 2008 ; Location in patent: Page/Page column 48 ; US 20080200454 A1 |
|
~%
3-Amino-4-(trif... CAS#:125483-00-3 |
| Literature: Liebigs Annalen der Chemie, , # 6 p. 569 - 579 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-AMINO-4-(TRIFLUOROMETHYL)BENZOICACID |
| 3-Amino-4-(trifluoromethyl)benzoic acid |
| BENZOIC ACID,3-AMINO-4-(TRIFLUOROMETHYL)- |
| ALLYLALPHA-D-GALACTOPYRANOSIDE |
| Benzoic acid, 3-amino-4-(trifluoromethyl)- |
| MFCD07784307 |
| 3-Amino-4-trifluoromethylbenzoic acid |