1-amino-2-chloroanthraquinone structure
|
Common Name | 1-amino-2-chloroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 117-07-7 | Molecular Weight | 257.67200 | |
| Density | 1.486g/cm3 | Boiling Point | 498.1ºC at 760mmHg | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.1ºC | |
| Name | 1-amino-2-chloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 498.1ºC at 760mmHg |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.67200 |
| Flash Point | 255.1ºC |
| Exact Mass | 257.02400 |
| PSA | 60.16000 |
| LogP | 3.27880 |
| Vapour Pressure | 4.66E-10mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | QQOBTPNGSQEDAS-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)ccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| monoaminochloroanthraquinone |
| 2-Chlor-1-amino-anthrachinon |
| 1-Amino-2-chloroanthraquinone |
| 2-chloro-1-aminoanthraquinone |
| 1-Amino-2-chlor-anthrachinon |
| 1-amino-2-chloro-9,10-anthraquinone |
| EINECS 204-170-9 |