1-amino-2-chloro-4-hydroxyanthraquinone structure
|
Common Name | 1-amino-2-chloro-4-hydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 2478-67-3 | Molecular Weight | 273.67100 | |
| Density | 1.593g/cm3 | Boiling Point | 538.1ºC at 760mmHg | |
| Molecular Formula | C14H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.2ºC | |
| Name | 1-amino-2-chloro-4-hydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 538.1ºC at 760mmHg |
| Molecular Formula | C14H8ClNO3 |
| Molecular Weight | 273.67100 |
| Flash Point | 279.2ºC |
| Exact Mass | 273.01900 |
| PSA | 80.39000 |
| LogP | 2.98440 |
| Vapour Pressure | 3.43E-12mmHg at 25°C |
| Index of Refraction | 1.746 |
| InChIKey | MFAVJLWGAQYYNX-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~97%
1-amino-2-chlor... CAS#:2478-67-3 |
| Literature: Ciba-Geigy Corporation Patent: US4657707 A1, 1987 ; |
|
~%
1-amino-2-chlor... CAS#:2478-67-3 |
| Literature: Ciba-Geigy Corporation Patent: US4657707 A1, 1987 ; |
|
~%
1-amino-2-chlor... CAS#:2478-67-3 |
| Literature: Bayer and Co. Patent: DE203083 ; |
|
~%
1-amino-2-chlor... CAS#:2478-67-3 |
| Literature: Bayer and Co. Patent: DE203083 ; |
|
~%
1-amino-2-chlor... CAS#:2478-67-3 |
| Literature: Bayer and Co. Patent: DE203083 ; |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Amino-2-chloro-4-hydroxyanthrachinon |
| EINECS 219-611-0 |
| 1-Amino-2-chlor-4-hydroxy-anthrachinon |
| 1-amino-2-chloro-4-hydroxyanthraquinone |
| 1-Hydroxy-3-chlor-4-aminoanthrachinon |
| 1-amino-2-chloro-4-hydroxy-9,10-anthraquinone |
| 1-amino-4-hydroxy-2-chloroanthraquinone |