5-Hydroxymebendazole D3 structure
|
Common Name | 5-Hydroxymebendazole D3 | ||
|---|---|---|---|---|
| CAS Number | 1173020-86-4 | Molecular Weight | 300.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12D3N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 5-Hydroxymebendazole D35-Hydroxymebendazole D3 is a deuterium labeled 5-Hydroxymebendazole. 5-Hydroxymebendazole is the one metabolite of Benzimidazoles[1]. |
| Name | trideuteriomethyl N-[6-[hydroxy(phenyl)methyl]-1H-benzimidazol-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Hydroxymebendazole D3 is a deuterium labeled 5-Hydroxymebendazole. 5-Hydroxymebendazole is the one metabolite of Benzimidazoles[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H12D3N3O3 |
|---|---|
| Molecular Weight | 300.32700 |
| Exact Mass | 300.13000 |
| PSA | 90.73000 |
| LogP | 2.83650 |
| InChIKey | IIQKUGXEGMZCLE-FIBGUPNXSA-N |
| SMILES | COC(=O)Nc1nc2ccc(C(O)c3ccccc3)cc2[nH]1 |
| [5-(Hydroxyphenylmethyl)-2-benzimidazolecarbamic acid methyl-d3 ester |
| Hydroxymebendazole-d3 |