Leuco Gentian Violet-d6 structure
|
Common Name | Leuco Gentian Violet-d6 | ||
|---|---|---|---|---|
| CAS Number | 1173023-92-1 | Molecular Weight | 379.57100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H25D6N3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Leuco Gentian Violet-d6Leucocrystal violet-d6 is the deuterium labeled Leucocrystal violet[1]. Leucocrystal violet is a triphenylmethane dye which can be used to detect antimony in environmental and biological samples using spectrophotometric techniques[2][3]. |
| Name | 4-[[4-[bis(trideuteriomethyl)amino]phenyl]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Description | Leucocrystal violet-d6 is the deuterium labeled Leucocrystal violet[1]. Leucocrystal violet is a triphenylmethane dye which can be used to detect antimony in environmental and biological samples using spectrophotometric techniques[2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C25H25D6N3 |
|---|---|
| Molecular Weight | 379.57100 |
| Exact Mass | 379.28900 |
| PSA | 9.72000 |
| LogP | 5.06480 |
| InChIKey | OAZWDJGLIYNYMU-WFGJKAKNSA-N |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~48%
Leuco Gentian V... CAS#:1173023-92-1 |
| Literature: Yang, Weicheng; Luo, Yong; Liu, Weixia; Deng, Xiaojun; Du, Xiaoning; Li, Meihua Journal of Labelled Compounds and Radiopharmaceuticals, 2011 , vol. 54, # 4 p. 211 - 213 |
|
~50%
Leuco Gentian V... CAS#:1173023-92-1 |
| Literature: Yang, Weicheng; Luo, Yong; Liu, Weixia; Deng, Xiaojun; Du, Xiaoning; Li, Meihua Journal of Labelled Compounds and Radiopharmaceuticals, 2011 , vol. 54, # 4 p. 211 - 213 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis(4-dimethylaminophenyl)-4-dimethylamino-d6-phenylmethane |
| Leucocrystal Violet-d6 |
| Leucomethyl Green-d6 |
| Leuco Gentian Violet-d6 |
| Leuco Basic Violet 3-d6 |