Clocinnamox mesylate structure
|
Common Name | Clocinnamox mesylate | ||
|---|---|---|---|---|
| CAS Number | 117332-69-1 | Molecular Weight | 601.11 | |
| Density | N/A | Boiling Point | 753.4ºC at 760mmHg | |
| Molecular Formula | C30H33ClN2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.4ºC | |
Use of Clocinnamox mesylateClocinnamox (mesylate) is a potent opioid antagonist acting at mu, kappa and delta-receptors. Clocinnamox is a selective mu-receptor antagonist than kappa and delta-receptors[1]. |
| Name | 14b-(p-chlorocinnamoylamino)-7,8-dihydro-n-cyclopropylmethylmorphinone mesylate |
|---|---|
| Synonym | More Synonyms |
| Description | Clocinnamox (mesylate) is a potent opioid antagonist acting at mu, kappa and delta-receptors. Clocinnamox is a selective mu-receptor antagonist than kappa and delta-receptors[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 753.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C30H33ClN2O7S |
| Molecular Weight | 601.11 |
| Flash Point | 409.4ºC |
| Exact Mass | 600.17000 |
| PSA | 141.62000 |
| LogP | 4.92970 |
| Vapour Pressure | 1.74E-23mmHg at 25°C |
| InChIKey | XAXNKAGAUFXFDO-JVJDXIHNSA-N |
| SMILES | CS(=O)(=O)O.O=C(C=Cc1ccc(Cl)cc1)NC12CCC(=O)C3Oc4c(O)ccc5c4C31CCN(CC1CC1)C2C5 |
| clocinnamox |
| threo Ifenprodil hemitartrate |
| CLOCINNAMOX MESYLATE |