4,5-Dihydro-2-(1,2,3,4-tetrahydro-1-naphthalenyl)-1H-imidazole mononitrate structure
|
Common Name | 4,5-Dihydro-2-(1,2,3,4-tetrahydro-1-naphthalenyl)-1H-imidazole mononitrate | ||
|---|---|---|---|---|
| CAS Number | 118201-38-0 | Molecular Weight | 263.29200 | |
| Density | 1.2 g/cm3 | Boiling Point | 393.5ºC at 760 mmHg | |
| Molecular Formula | C13H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
Use of 4,5-Dihydro-2-(1,2,3,4-tetrahydro-1-naphthalenyl)-1H-imidazole mononitrateTetrahydrozoline (Tetryzoline) nitrate , a derivative of imidazoline, is an α-adrenergic agonist that causes vasoconstriction. Tetrahydrozoline is widely used for the research of nasal congestion and conjunctival congestion[1][2]. |
| Name | nitric acid,2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Description | Tetrahydrozoline (Tetryzoline) nitrate , a derivative of imidazoline, is an α-adrenergic agonist that causes vasoconstriction. Tetrahydrozoline is widely used for the research of nasal congestion and conjunctival congestion[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2 g/cm3 |
|---|---|
| Boiling Point | 393.5ºC at 760 mmHg |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.29200 |
| Flash Point | 191.8ºC |
| Exact Mass | 263.12700 |
| PSA | 90.44000 |
| LogP | 2.04810 |
| Vapour Pressure | 4.8E-06mmHg at 25°C |
| InChIKey | SVQFLMKSDLCPAY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])O.c1ccc2c(c1)CCCC2C1=NCCN1 |
| I06-1242 |
| Tetrahydrozoline nitrate (JAN) |
| UNII-8P9X484T3F |
| Narbel (TN) |