Flumequine-13C3 structure
|
Common Name | Flumequine-13C3 | ||
|---|---|---|---|---|
| CAS Number | 1185049-09-5 | Molecular Weight | 264.226 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C1113C3H12FNO3 | Melting Point | 253-255°C | |
| MSDS | USA | Flash Point | N/A | |
Use of Flumequine-13C3Flumequine-13C3 is the 13C3 labeled Flumequine. Flumequine (R-802) is a quinolone antibiotic, and acts as a topoisomerase II inhibitor, with an IC50 of 15 μM (3.92 μg/mL). |
| Name | 9-Fluoro-5-methyl-1-oxo(1,2-13C2)-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-(13C)carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Flumequine-13C3 is the 13C3 labeled Flumequine. Flumequine (R-802) is a quinolone antibiotic, and acts as a topoisomerase II inhibitor, with an IC50 of 15 μM (3.92 μg/mL). |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 253-255°C |
| Molecular Formula | C1113C3H12FNO3 |
| Molecular Weight | 264.226 |
| Exact Mass | 264.090179 |
| Index of Refraction | 1.646 |
| InChIKey | DPSPPJIUMHPXMA-AIGZGMKWSA-N |
| SMILES | CC1CCc2cc(F)cc3c(=O)c(C(=O)O)cn1c23 |
| Storage condition | -20°C Freezer |
| RIDADR | NONH for all modes of transport |
|---|
| 9-Fluoro-5-methyl-1-oxo(1,2-13C2)-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-(13C)carboxylic acid |
| 1H,5H-Benzo[ij]quinolizine-1,2-13C2-2-carboxylic-13C acid, 9-fluoro-6,7-dihydro-5-methyl-1-oxo- |