4-acetyl-3-phenylisochromen-1-one structure
|
Common Name | 4-acetyl-3-phenylisochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 118520-80-2 | Molecular Weight | 264.27500 | |
| Density | 1.267g/cm3 | Boiling Point | 456.7ºC at 760mmHg | |
| Molecular Formula | C17H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | 4-acetyl-3-phenylisochromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 456.7ºC at 760mmHg |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.27500 |
| Flash Point | 205ºC |
| Exact Mass | 264.07900 |
| PSA | 47.28000 |
| LogP | 3.66260 |
| Vapour Pressure | 1.59E-08mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | HHBKSVMBZCQDGK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(-c2ccccc2)oc(=O)c2ccccc12 |
|
~%
4-acetyl-3-phen... CAS#:118520-80-2 |
| Literature: Nagarajan, A.; Balasubramanian, Tiruvenkat R. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, p. 917 - 919 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-acetyl-3-phenyl-1h-isochromen-1-one |
| 4-acetyl-3-phenyl-isochromene-1-one |
| 4-acetyl-3-phenylisocoumarin |
| 1H-2-Benzopyran-1-one,4-acetyl-3-phenyl |