Resveratrol-(4-Hydroxyphenyl)-13c6 structure
|
Common Name | Resveratrol-(4-Hydroxyphenyl)-13c6 | ||
|---|---|---|---|---|
| CAS Number | 1185247-70-4 | Molecular Weight | 234.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07, GHS08 |
Signal Word | Danger | |
Use of Resveratrol-(4-Hydroxyphenyl)-13c6Resveratrol-(4-Hydroxyphenyl)-13CN6 is the 13C labeled Resveratrol-(4-Hydroxyphenyl)[1]. |
| Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Resveratrol-(4-Hydroxyphenyl)-13CN6 is the 13C labeled Resveratrol-(4-Hydroxyphenyl)[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 234.19900 |
| Exact Mass | 234.09900 |
| PSA | 60.69000 |
| LogP | 2.97380 |
| InChIKey | LUKBXSAWLPMMSZ-OYESDQHJSA-N |
| SMILES | Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| Storage condition | 20°C |
| Symbol |
GHS05, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H334 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P342 + P311 |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| 3,4 inverted exclamation marka,5-Trihydroxy-trans-stilbene-13C6 |
| trans-3,4',5-Trihydroxystilbene-13C6 |
| 3,4',5-Trihydroxy-trans-stilbene-13C6 |
| Resveratrol-13C6 |
| trans-Resveratrol-13C6 |