AB-FUBINACA structure
|
Common Name | AB-FUBINACA | ||
|---|---|---|---|---|
| CAS Number | 1185282-01-2 | Molecular Weight | 368.405 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 659.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H21FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.5±30.1 °C | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 659.3±50.0 °C at 760 mmHg |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.405 |
| Flash Point | 352.5±30.1 °C |
| Exact Mass | 368.164856 |
| PSA | 90.01000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | AKOOIMKXADOPDA-KRWDZBQOSA-N |
| SMILES | CC(C)C(NC(=O)c1nn(Cc2ccc(F)cc2)c2ccccc12)C(N)=O |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| HS Code | 2933990090 |
|
~63%
AB-FUBINACA CAS#:1185282-01-2 |
| Literature: Pfizer Inc. Patent: US2011/28447 A1, 2011 ; Location in patent: Page/Page column 34 ; |
|
~%
AB-FUBINACA CAS#:1185282-01-2 |
| Literature: US2011/28447 A1, ; |
|
~%
AB-FUBINACA CAS#:1185282-01-2 |
| Literature: US2011/28447 A1, ; |
|
~%
AB-FUBINACA CAS#:1185282-01-2 |
| Literature: US2011/28447 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-N-(1-Amino-3-methyl-1-oxobutan-2-yl)-1-(4-fluorobenzyl)-1H-indazole-3-carboxamide |
| 1H-Indazole-3-carboxamide, N-[(1S)-1-(aminocarbonyl)-2-methylpropyl]-1-[(4-fluorophenyl)methyl]- |
| AB-FUBINACA |
| N-[(2S)-1-Amino-3-methyl-1-oxo-2-butanyl]-1-(4-fluorobenzyl)-1H-indazole-3-carboxamide |