2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide
2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide structure
|
Common Name | 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 118564-52-6 | Molecular Weight | 288.42800 | |
| Density | 1.04g/cm3 | Boiling Point | 416.6ºC at 760 mmHg | |
| Molecular Formula | C18H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 416.6ºC at 760 mmHg |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.42800 |
| Flash Point | 205.7ºC |
| Exact Mass | 288.22000 |
| PSA | 35.83000 |
| LogP | 4.40220 |
| Vapour Pressure | 3.79E-07mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | SPHISTHYEUHNGE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(NC(=O)C(C)N2CCCCCC2)c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: Polar surface area (PSA) of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is 35.83000. |
| Q: What is the InChIKey of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: InChIKey of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is SPHISTHYEUHNGE-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: Related upstream materials(CAS) of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide: 111-49-9;104509-24-2;88-05-1. |
| Q: What is the molecular formula of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: Molecular formula of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is C18H28N2O. |
| Q: What is the molecular weight of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: Molecular weight of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is 288.42800. |
| Q: What is the CAS number of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: CAS number of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is 118564-52-6. |
| Q: What is the boiling point of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: Boiling point of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is 416.6ºC at 760 mmHg. |
| Q: What is the English name of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: The English name of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide. |
| Q: What is the SMILES notation of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: SMILES notation of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is Cc1cc(C)c(NC(=O)C(C)N2CCCCCC2)c(C)c1. |
| Q: What is the LogP of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide? |
| A: LogP of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)propanamide is 4.40220. |