Cuniloside B structure
|
Common Name | Cuniloside B | ||
|---|---|---|---|---|
| CAS Number | 1187303-40-7 | Molecular Weight | 512.590 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 680.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H40O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.3±25.0 °C | |
Use of Cuniloside BCuniloside B (Eucalmaidin E) is a non-volatile glucose monoterpene ester. Cuniloside B can be used as a fragrance additive[1]. |
| Name | 1,6-Bis-O-{[(4R)-4-(2-hydroxy-2-propanyl)-1-cyclohexen-1-yl]carbo nyl}-β-D-glucopyranose |
|---|---|
| Synonym | More Synonyms |
| Description | Cuniloside B (Eucalmaidin E) is a non-volatile glucose monoterpene ester. Cuniloside B can be used as a fragrance additive[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 680.4±55.0 °C at 760 mmHg |
| Molecular Formula | C26H40O10 |
| Molecular Weight | 512.590 |
| Flash Point | 221.3±25.0 °C |
| Exact Mass | 512.262146 |
| PSA | 162.98000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | JOLLIDAUJSAZHE-KWNAMUSHSA-N |
| SMILES | CC(C)(O)C1CC=C(C(=O)OCC2OC(OC(=O)C3=CCC(C(C)(C)O)CC3)C(O)C(O)C2O)CC1 |
| Hazard Codes | Xi |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,6-dinitro-phenazine |
| cuniloside B |
| Phenazine,1,6-dinitro |
| eucalmaidin E |
| 1,6-Bis-O-{[(4R)-4-(2-hydroxy-2-propanyl)-1-cyclohexen-1-yl]carbonyl}-β-D-glucopyranose |
| 1,6-Dinitrophenazin |
| β-D-Glucopyranose, 1,6-bis-O-[[(4R)-4-(1-hydroxy-1-methylethyl)-1-cyclohexen-1-yl]carbonyl]- |
| BZGCNHUWISZVPK-UHFFFAOYSA |