7-methoxy-3-methyl-2-phenyl-4(3H)-Quinazolinone structure
|
Common Name | 7-methoxy-3-methyl-2-phenyl-4(3H)-Quinazolinone | ||
|---|---|---|---|---|
| CAS Number | 1187568-16-6 | Molecular Weight | 266.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7-methoxy-3-methyl-2-phenyl-4(3H)-QuinazolinoneDK3 is a potent and selective estrogen-related receptor alpha (ERRα) agonist[1]. |
| Name | 7-methoxy-3-methyl-2-phenylquinazolin-4-one |
|---|
| Description | DK3 is a potent and selective estrogen-related receptor alpha (ERRα) agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H14N2O2 |
|---|---|
| Molecular Weight | 266.29500 |
| Exact Mass | 266.10600 |
| PSA | 44.12000 |
| LogP | 2.60910 |
| InChIKey | CAPYSCGIBNZCLS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)n(C)c(-c3ccccc3)nc2c1 |