N-Boc-piperidine-2-ethanol structure
|
Common Name | N-Boc-piperidine-2-ethanol | ||
|---|---|---|---|---|
| CAS Number | 118811-03-3 | Molecular Weight | 229.316 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 324.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H23NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 149.8±20.4 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | tert-butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.1±15.0 °C at 760 mmHg |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.316 |
| Flash Point | 149.8±20.4 °C |
| Exact Mass | 229.167801 |
| PSA | 49.77000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | LTVQOFUGXMVESU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCO |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319-H400 |
| Precautionary Statements | P273-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R25 |
| Safety Phrases | 24/25-45 |
| RIDADR | UN 2810 |
| HS Code | 2933399090 |
|
~99%
N-Boc-piperidin... CAS#:118811-03-3 |
| Literature: Rouden, Jacques; Seitz, Thomas; Lemoucheux, Laurent; Lasne, Marie-Claire Journal of Organic Chemistry, 2004 , vol. 69, # 11 p. 3787 - 3793 |
|
~95%
N-Boc-piperidin... CAS#:118811-03-3 |
| Literature: Schering Corporation Patent: US6362188 B1, 2002 ; US 6362188 B1 |
|
~97%
N-Boc-piperidin... CAS#:118811-03-3 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP278621 B1, 1991 ; |
|
~%
N-Boc-piperidin... CAS#:118811-03-3 |
| Literature: US6162813 A1, ; US 6162813 A US6150522 A1, ; |
|
~81%
N-Boc-piperidin... CAS#:118811-03-3 |
| Literature: Hyundai Electronics Industries Co., Ltd. Patent: US2002/151666 A1, 2002 ; |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate |
| tert-Butyl (2S)-2-(2-hydroxyethyl)piperidine-1-carboxylate |
| N-Boc-2-piperidineethanol |
| F2184-0204 |
| 2-Methyl-2-propanyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate |
| 1-N-Boc-Piperidine-2-ethanol |
| 1-Piperidinecarboxylic acid, 2-(2-hydroxyethyl)-, 1,1-dimethylethyl ester |
| MFCD03701252 |
| N-Boc-piperidine-2-ethanol |
| N-Boc-2-hydroxyethylpiperidine |