S-Boc-2-Mercapto-4,6-Dimethylpyrimidine structure
|
Common Name | S-Boc-2-Mercapto-4,6-Dimethylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 41840-28-2 | Molecular Weight | 240.32200 | |
| Density | 1.15g/cm3 | Boiling Point | 358.8ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2S | Melting Point | 48-51 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | S-Boc-2-Mercapto-4,6-Dimethylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 358.8ºC at 760 mmHg |
| Melting Point | 48-51 °C(lit.) |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.32200 |
| Flash Point | >230 °F |
| Exact Mass | 240.09300 |
| PSA | 77.38000 |
| LogP | 3.12060 |
| Index of Refraction | 1.534 |
| InChIKey | POTDIELOEHTPJN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(SC(=O)OC(C)(C)C)n1 |
| Storage condition | Store at RT. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(tert-Butoxycarbonylthio)-4,6-diMethylpyriMidine [Boc Agent |
| tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate |
| 2-Boc-thio-4,6-dimethylpyrimidine |
| EINECS 255-562-1 |
| O-tert-Butyl-S-(4,6-dimethyl-2-pyrimidinyl) thiocarbonate,Boc-S |
| MFCD00006080 |