4'-BENZYLOXY-2'-METHOXY-3'-METHYLACETOPHENONE structure
|
Common Name | 4'-BENZYLOXY-2'-METHOXY-3'-METHYLACETOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 118824-96-7 | Molecular Weight | 270.32300 | |
| Density | 1.099g/cm3 | Boiling Point | 423.2ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | 36-39ºC(lit.) | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 1-(2-methoxy-3-methyl-4-phenylmethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760 mmHg |
| Melting Point | 36-39ºC(lit.) |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | >230 °F |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.78520 |
| Vapour Pressure | 2.27E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | ARIPVVKYYGZBBM-UHFFFAOYSA-N |
| SMILES | COc1c(C(C)=O)ccc(OCc2ccccc2)c1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
|
~81%
4'-BENZYLOXY-2'... CAS#:118824-96-7 |
| Literature: Raphael, Ralph A.; Ravenscroft, Paul Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1823 - 1828 |
|
~%
4'-BENZYLOXY-2'... CAS#:118824-96-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1823 - 1828 |
|
~%
4'-BENZYLOXY-2'... CAS#:118824-96-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1823 - 1828 |
| MFCD00010753 |
| 4'-Benzyloxy-2'-methoxy-3'-methylacetophenone |