BMS-764459 structure
|
Common Name | BMS-764459 | ||
|---|---|---|---|---|
| CAS Number | 1188407-45-5 | Molecular Weight | 405.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21F2N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BMS-764459BMS-764459 is a CRF1 antagonist. BMS-764459 can be used for the research of neurological disorders such as depression and anxiety. BMS-764459 is also an atypical CYP1A1 inducer[1][2]. |
| Name | 4-[(1S)-1-Cyclopropyl-2-methoxyethyl]-6-{[6-(difluoromethoxy)-2,5 -dimethyl-3-pyridinyl]amino}-5-oxo-4,5-dihydro-2-pyrazinecarbonit rile |
|---|
| Description | BMS-764459 is a CRF1 antagonist. BMS-764459 can be used for the research of neurological disorders such as depression and anxiety. BMS-764459 is also an atypical CYP1A1 inducer[1][2]. |
|---|---|
| Related Catalog | |
| Target |
CRF1[1], CYP1A1[2] |
| References |
| Molecular Formula | C19H21F2N5O3 |
|---|---|
| Molecular Weight | 405.39900 |
| Exact Mass | 405.16100 |
| PSA | 105.29000 |
| LogP | 2.49118 |
| InChIKey | PJMUNXORSUNUCV-OAHLLOKOSA-N |
| SMILES | COCC(C1CC1)n1cc(C#N)nc(Nc2cc(C)c(OC(F)F)nc2C)c1=O |