5-O-Desmethyl donepezil-d5 structure
|
Common Name | 5-O-Desmethyl donepezil-d5 | ||
|---|---|---|---|---|
| CAS Number | 1189929-21-2 | Molecular Weight | 370.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22D5NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-O-Desmethyl donepezil-d55-O-Desmethyl donepezil-d5 is deuterium labeled 5-O-Desmethyl donepezil. |
| Name | 5-hydroxy-6-methoxy-2-[[1-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | 5-O-Desmethyl donepezil-d5 is deuterium labeled 5-O-Desmethyl donepezil. |
|---|---|
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C23H22D5NO3 |
|---|---|
| Molecular Weight | 370.50 |
| Exact Mass | 370.23000 |
| PSA | 49.77000 |
| LogP | 3.99600 |
| InChIKey | DSMISVLYMKJMLP-VIQYUKPQSA-N |
| SMILES | COc1cc2c(cc1O)CC(CC1CCN(Cc3ccccc3)CC1)C2=O |
| 5-O-Desmethyl Donepezil-d5 |