N,N'-(4-nitro-1,3-phenylene)bis(acetamide) structure
|
Common Name | N,N'-(4-nitro-1,3-phenylene)bis(acetamide) | ||
|---|---|---|---|---|
| CAS Number | 119-76-6 | Molecular Weight | 237.21200 | |
| Density | 1.416g/cm3 | Boiling Point | 548.9ºC at 760mmHg | |
| Molecular Formula | C10H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.8ºC | |
| Name | N-(3-acetamido-4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 548.9ºC at 760mmHg |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21200 |
| Flash Point | 285.8ºC |
| Exact Mass | 237.07500 |
| PSA | 111.00000 |
| LogP | 3.33380 |
| Vapour Pressure | 4.22E-12mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | BBPXRFUIVJRWKY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])c(NC(C)=O)c1 |
| HS Code | 2924299090 |
|---|
|
~86%
N,N'-(4-nitro-1... CAS#:119-76-6 |
| Literature: Jeong, Euigyung; Freeman, Harold S.; Claxton, Larry D. Dyes and Pigments, 2010 , vol. 87, # 2 p. 100 - 108 |
|
~%
N,N'-(4-nitro-1... CAS#:119-76-6 |
| Literature: Barbaglia Chemische Berichte, 1874 , vol. 7, p. 1257 |
|
~%
N,N'-(4-nitro-1... CAS#:119-76-6 |
| Literature: Phillips Journal of the Chemical Society, 1930 , p. 1910,1913 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 204-349-1 |
| 4-Nitro-N.N'-diacetyl-m-phenylendiamin |
| 4-Nitro-1.3-bis-acetamino-benzol |